C15H21N5O2S — CID 2106072
1-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione (PubChem CID 2106072) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione.
| Compound Name | 1-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione |
|---|---|
| PubChem CID | 2106072 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione |
| SMILES | COc1ccc(-n2nnn(CN3C[C@H](C)O[C@@H](C)C3)c2=S)cc1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-8-18(9-12(2)22-11)10-19-15(23)20(17-16-19)13-4-6-14(21-3)7-5-13/h4-7,11-12H,8-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | UKCZURHKUIXYQX-RYUDHWBXSA-N |
| XLogP | 1.87 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|