C17H19ClN5S+ — CID 9243081
benzyl-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-ethylazanium (PubChem CID 9243081) has the molecular formula C17H19ClN5S+ and a molecular weight of 360.89 g/mol. Its IUPAC name is benzyl-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-ethylazanium.
| Compound Name | benzyl-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-ethylazanium |
|---|---|
| PubChem CID | 9243081 |
| Molecular Formula | C17H19ClN5S+ |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | benzyl-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-ethylazanium |
| SMILES | CC[NH+](Cc1ccccc1)Cn1nnn(-c2cccc(Cl)c2)c1=S |
| InChI | InChI=1S/C17H18ClN5S/c1-2-21(12-14-7-4-3-5-8-14)13-22-17(24)23(20-19-22)16-10-6-9-15(18)11-16/h3-11H,2,12-13H2,1H3/p+1 |
| InChIKey | HBVPESXRMVQSEQ-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|