C21H25ClN4 — CID 164681831
5-benzyl-3-(3-chlorophenyl)-N,N-dipropyltriazol-4-amine (PubChem CID 164681831) has the molecular formula C21H25ClN4 and a molecular weight of 368.91 g/mol. Its IUPAC name is 5-benzyl-3-(3-chlorophenyl)-N,N-dipropyltriazol-4-amine.
| Compound Name | 5-benzyl-3-(3-chlorophenyl)-N,N-dipropyltriazol-4-amine |
|---|---|
| PubChem CID | 164681831 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 5-benzyl-3-(3-chlorophenyl)-N,N-dipropyltriazol-4-amine |
| SMILES | CCCN(CCC)c1c(Cc2ccccc2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H25ClN4/c1-3-13-25(14-4-2)21-20(15-17-9-6-5-7-10-17)23-24-26(21)19-12-8-11-18(22)16-19/h5-12,16H,3-4,13-15H2,1-2H3 |
| InChIKey | ZYSSDRAELUXMBP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |