C22H28N4 — CID 164681820
5-benzyl-3-(3-methylphenyl)-N,N-dipropyltriazol-4-amine (PubChem CID 164681820) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 5-benzyl-3-(3-methylphenyl)-N,N-dipropyltriazol-4-amine.
| Compound Name | 5-benzyl-3-(3-methylphenyl)-N,N-dipropyltriazol-4-amine |
|---|---|
| PubChem CID | 164681820 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 5-benzyl-3-(3-methylphenyl)-N,N-dipropyltriazol-4-amine |
| SMILES | CCCN(CCC)c1c(Cc2ccccc2)nnn1-c1cccc(C)c1 |
| InChI | InChI=1S/C22H28N4/c1-4-14-25(15-5-2)22-21(17-19-11-7-6-8-12-19)23-24-26(22)20-13-9-10-18(3)16-20/h6-13,16H,4-5,14-15,17H2,1-3H3 |
| InChIKey | LJGWPQVISWAAMK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |