C12H15ClN4S — CID 113226497
1-(5-chlorothiophen-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine (PubChem CID 113226497) has the molecular formula C12H15ClN4S and a molecular weight of 282.80 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 113226497 |
| Molecular Formula | C12H15ClN4S |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine |
| SMILES | Clc1ccc(CNCc2nnc3n2CCCC3)s1 |
| InChI | InChI=1S/C12H15ClN4S/c13-10-5-4-9(18-10)7-14-8-12-16-15-11-3-1-2-6-17(11)12/h4-5,14H,1-3,6-8H2 |
| InChIKey | KYRCMENXQNCSET-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |