C11H15N5S — CID 103792668
N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-5-yl)methanamine (PubChem CID 103792668) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-5-yl)methanamine.
| Compound Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 103792668 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-5-yl)methanamine |
| SMILES | c1ncc(CNCc2nnc3n2CCCC3)s1 |
| InChI | InChI=1S/C11H15N5S/c1-2-4-16-10(3-1)14-15-11(16)7-12-5-9-6-13-8-17-9/h6,8,12H,1-5,7H2 |
| InChIKey | CJYKULPYLMDXAH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |