C10H18N4OS — CID 107077805
2-methylsulfinyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine (PubChem CID 107077805) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-methylsulfinyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine.
| Compound Name | 2-methylsulfinyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107077805 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-methylsulfinyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine |
| SMILES | CS(=O)CCNCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C10H18N4OS/c1-16(15)7-5-11-8-10-13-12-9-4-2-3-6-14(9)10/h11H,2-8H2,1H3 |
| InChIKey | LVUNKWXMDHBPFH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|