C11H19N5O — CID 107077197
N-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)acetamide (PubChem CID 107077197) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is N-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)acetamide.
| Compound Name | N-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 107077197 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)acetamide |
| SMILES | CCNC(=O)CNCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C11H19N5O/c1-2-13-11(17)8-12-7-10-15-14-9-5-3-4-6-16(9)10/h12H,2-8H2,1H3,(H,13,17) |
| InChIKey | WJYZTCLMRGBNQK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |