C16H28N4O — CID 107077584
4,4-dimethyl-1-[(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methyl]cyclohexan-1-ol (PubChem CID 107077584) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methyl]cyclohexan-1-ol.
| Compound Name | 4,4-dimethyl-1-[(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 107077584 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 4,4-dimethyl-1-[(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methyl]cyclohexan-1-ol |
| SMILES | CC1(C)CCC(O)(CNCc2nnc3n2CCCC3)CC1 |
| InChI | InChI=1S/C16H28N4O/c1-15(2)6-8-16(21,9-7-15)12-17-11-14-19-18-13-5-3-4-10-20(13)14/h17,21H,3-12H2,1-2H3 |
| InChIKey | MHAMBEBSVMKLAX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |