C8H14N4O — CID 82654891
N-methoxy-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine (PubChem CID 82654891) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is N-methoxy-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine.
| Compound Name | N-methoxy-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 82654891 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-methoxy-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine |
| SMILES | CONCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C8H14N4O/c1-13-9-6-8-11-10-7-4-2-3-5-12(7)8/h9H,2-6H2,1H3 |
| InChIKey | VRDMSEWYNLJFJM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|