C17H18F6N4O — CID 97196735
1-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine (PubChem CID 97196735) has the molecular formula C17H18F6N4O and a molecular weight of 408.35 g/mol. Its IUPAC name is 1-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine.
| Compound Name | 1-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 97196735 |
| Molecular Formula | C17H18F6N4O |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)methanamine |
| SMILES | F[C@@H](C(F)(F)F)C(F)(F)Oc1ccc(CNCc2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C17H18F6N4O/c18-15(16(19,20)21)17(22,23)28-12-6-4-11(5-7-12)9-24-10-14-26-25-13-3-1-2-8-27(13)14/h4-7,15,24H,1-3,8-10H2/t15-/m0/s1 |
| InChIKey | LCGNCAYAIHHGEW-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |