C22H24F2N4O — CID 119111946
N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine (PubChem CID 119111946) has the molecular formula C22H24F2N4O and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine.
| Compound Name | N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine |
|---|---|
| PubChem CID | 119111946 |
| Molecular Formula | C22H24F2N4O |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[[4-(3,5-difluorophenoxy)phenyl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine |
| SMILES | Fc1cc(F)cc(Oc2ccc(CNCCc3nnc4n3CCCCC4)cc2)c1 |
| InChI | InChI=1S/C22H24F2N4O/c23-17-12-18(24)14-20(13-17)29-19-7-5-16(6-8-19)15-25-10-9-22-27-26-21-4-2-1-3-11-28(21)22/h5-8,12-14,25H,1-4,9-11,15H2 |
| InChIKey | NAHMLFAUUOFNOM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|