C20H29FN6O — CID 111681102
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 111681102) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111681102 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2n1CCCCC2)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H29FN6O/c1-15(28-17-8-6-7-16(21)13-17)14-24-20(22-2)23-11-10-19-26-25-18-9-4-3-5-12-27(18)19/h6-8,13,15H,3-5,9-12,14H2,1-2H3,(H2,22,23,24) |
| InChIKey | VONRXZDIARXZHB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|