C19H27FN6O — CID 109476183
1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 109476183) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109476183 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCC(CN/C(=N\C)NCc1nnc2n1CCCC2)Oc1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN6O/c1-3-15(27-16-8-6-7-14(20)11-16)12-22-19(21-2)23-13-18-25-24-17-9-4-5-10-26(17)18/h6-8,11,15H,3-5,9-10,12-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | MPNZUAVYNLOOQA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|