C20H29ClN6O — CID 111294711
1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine (PubChem CID 111294711) has the molecular formula C20H29ClN6O and a molecular weight of 404.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111294711 |
| Molecular Formula | C20H29ClN6O |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C20H29ClN6O/c1-3-22-19(25(2)15-16-9-4-5-10-17(16)21)23-12-8-14-27-20(28)26-13-7-6-11-18(26)24-27/h4-5,9-10H,3,6-8,11-15H2,1-2H3,(H,22,23) |
| InChIKey | SNFMLCWQQMWHEZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|