C21H35IN4O — CID 111287604
3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111287604) has the molecular formula C21H35IN4O and a molecular weight of 486.44 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287604 |
| Molecular Formula | C21H35IN4O |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCCCC1=O)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C21H34N4O.HI/c1-4-22-21(24(3)17-19-12-8-7-11-18(19)2)23-14-10-16-25-15-9-5-6-13-20(25)26;/h7-8,11-12H,4-6,9-10,13-17H2,1-3H3,(H,22,23);1H |
| InChIKey | OEZMUNGTKGVMBA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|