C26H32N4O2S — CID 2901421
5-[(4-cyclohexylphenoxy)methyl]-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 2901421) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 5-[(4-cyclohexylphenoxy)methyl]-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-[(4-cyclohexylphenoxy)methyl]-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2901421 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 5-[(4-cyclohexylphenoxy)methyl]-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCOCC2)nc(COc2ccc(C3CCCCC3)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H32N4O2S/c33-26-29(20-28-15-17-31-18-16-28)27-25(30(26)23-9-5-2-6-10-23)19-32-24-13-11-22(12-14-24)21-7-3-1-4-8-21/h2,5-6,9-14,21H,1,3-4,7-8,15-20H2 |
| InChIKey | JQOIWVQLCRCDAF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|