C26H26N4S — CID 40830160
5-benzyl-4-phenyl-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 40830160) has the molecular formula C26H26N4S and a molecular weight of 426.59 g/mol. Its IUPAC name is 5-benzyl-4-phenyl-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-benzyl-4-phenyl-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 40830160 |
| Molecular Formula | C26H26N4S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-benzyl-4-phenyl-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CC[C@H](c3ccccc3)C2)nc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H26N4S/c31-26-29(20-28-17-16-23(19-28)22-12-6-2-7-13-22)27-25(18-21-10-4-1-5-11-21)30(26)24-14-8-3-9-15-24/h1-15,23H,16-20H2/t23-/m0/s1 |
| InChIKey | YZOMUNVLYWOKIS-QHCPKHFHSA-N |
| XLogP | 5.44 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|