C26H27ClN6OS — CID 10815468
5-benzyl-4-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 10815468) has the molecular formula C26H27ClN6OS and a molecular weight of 507.06 g/mol. Its IUPAC name is 5-benzyl-4-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-benzyl-4-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10815468 |
| Molecular Formula | C26H27ClN6OS |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 5-benzyl-4-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CN1CCN(Cn2nc(Cc3ccccc3)n(/N=C/c3ccc(-c4ccc(Cl)cc4)o3)c2=S)CC1 |
| InChI | InChI=1S/C26H27ClN6OS/c1-30-13-15-31(16-14-30)19-32-26(35)33(25(29-32)17-20-5-3-2-4-6-20)28-18-23-11-12-24(34-23)21-7-9-22(27)10-8-21/h2-12,18H,13-17,19H2,1H3/b28-18+ |
| InChIKey | INFHPJAYDWVYGM-MTDXEUNCSA-N |
| XLogP | 5.01 |
| TPSA | 54.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|