C27H36ClN5O3 — CID 57084587
1-[[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-4-hydroxy-3-[8-(4-methylpiperazin-1-yl)octyl]imidazol-2-one (PubChem CID 57084587) has the molecular formula C27H36ClN5O3 and a molecular weight of 514.07 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-4-hydroxy-3-[8-(4-methylpiperazin-1-yl)octyl]imidazol-2-one.
| Compound Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-4-hydroxy-3-[8-(4-methylpiperazin-1-yl)octyl]imidazol-2-one |
|---|---|
| PubChem CID | 57084587 |
| Molecular Formula | C27H36ClN5O3 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-4-hydroxy-3-[8-(4-methylpiperazin-1-yl)octyl]imidazol-2-one |
| SMILES | CN1CCN(CCCCCCCCn2c(O)cn(N=Cc3ccc(-c4ccc(Cl)cc4)o3)c2=O)CC1 |
| InChI | InChI=1S/C27H36ClN5O3/c1-30-16-18-31(19-17-30)14-6-4-2-3-5-7-15-32-26(34)21-33(27(32)35)29-20-24-12-13-25(36-24)22-8-10-23(28)11-9-22/h8-13,20-21,34H,2-7,14-19H2,1H3 |
| InChIKey | DLMWFOIIJXLNIO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|