C17H16ClN3O3 — CID 29228573
(5R)-3-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 29228573) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is (5R)-3-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 29228573 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (5R)-3-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(/N=C\c2ccc(-c3ccc(Cl)cc3)o2)C1=O |
| InChI | InChI=1S/C17H16ClN3O3/c1-3-17(2)15(22)21(16(23)20-17)19-10-13-8-9-14(24-13)11-4-6-12(18)7-5-11/h4-10H,3H2,1-2H3,(H,20,23)/b19-10-/t17-/m1/s1 |
| InChIKey | JMUVMYMUYBVXEX-KLSKMWHSSA-N |
| XLogP | 3.65 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|