C13H13F2N3O2 — CID 2644230
(5R)-3-[(2,6-difluorophenyl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 2644230) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is (5R)-3-[(2,6-difluorophenyl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2,6-difluorophenyl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2644230 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (5R)-3-[(2,6-difluorophenyl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(N=Cc2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C13H13F2N3O2/c1-3-13(2)11(19)18(12(20)17-13)16-7-8-9(14)5-4-6-10(8)15/h4-7H,3H2,1-2H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | NRLJIZKJAUPDFG-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|