C11H12BrN3O2S — CID 42995813
3-[(E)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 42995813) has the molecular formula C11H12BrN3O2S and a molecular weight of 330.21 g/mol. Its IUPAC name is 3-[(E)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(E)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42995813 |
| Molecular Formula | C11H12BrN3O2S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3-[(E)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1(C)NC(=O)N(/N=C/c2cc(Br)cs2)C1=O |
| InChI | InChI=1S/C11H12BrN3O2S/c1-3-11(2)9(16)15(10(17)14-11)13-5-8-4-7(12)6-18-8/h4-6H,3H2,1-2H3,(H,14,17)/b13-5+ |
| InChIKey | XTTPTEXAYHRIGZ-WLRTZDKTSA-N |
| XLogP | 2.57 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|