C16H14BrN3O2S — CID 9297167
(5R)-3-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9297167) has the molecular formula C16H14BrN3O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is (5R)-3-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297167 |
| Molecular Formula | C16H14BrN3O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | (5R)-3-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(/N=C\c2cc(Br)cs2)C1=O |
| InChI | InChI=1S/C16H14BrN3O2S/c1-2-16(11-6-4-3-5-7-11)14(21)20(15(22)19-16)18-9-13-8-12(17)10-23-13/h3-10H,2H2,1H3,(H,19,22)/b18-9-/t16-/m1/s1 |
| InChIKey | BZFDBFKASLXMNZ-BZMUBCNJSA-N |
| XLogP | 3.70 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|