C21H21F2N3O3 — CID 9297488
(5R)-3-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9297488) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is (5R)-3-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297488 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (5R)-3-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(/N=C\c2cc(C)c(OC(F)F)c(C)c2)C1=O |
| InChI | InChI=1S/C21H21F2N3O3/c1-4-21(16-8-6-5-7-9-16)18(27)26(20(28)25-21)24-12-15-10-13(2)17(14(3)11-15)29-19(22)23/h5-12,19H,4H2,1-3H3,(H,25,28)/b24-12-/t21-/m1/s1 |
| InChIKey | DGRSTNYOLXGWMZ-YCIJSJTNSA-N |
| XLogP | 4.10 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|