C20H19F2N3O4 — CID 9297392
(5S)-3-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9297392) has the molecular formula C20H19F2N3O4 and a molecular weight of 403.39 g/mol. Its IUPAC name is (5S)-3-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297392 |
| Molecular Formula | C20H19F2N3O4 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (5S)-3-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(/N=C\c2ccc(OC)c(OC(F)F)c2)C1=O |
| InChI | InChI=1S/C20H19F2N3O4/c1-3-20(14-7-5-4-6-8-14)17(26)25(19(27)24-20)23-12-13-9-10-15(28-2)16(11-13)29-18(21)22/h4-12,18H,3H2,1-2H3,(H,24,27)/b23-12-/t20-/m0/s1 |
| InChIKey | HOQJOQIBAUBMSK-BIFQTZPZSA-N |
| XLogP | 3.49 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|