C20H19N3O5 — CID 9297483
(5R)-5-ethyl-3-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-5-phenylimidazolidine-2,4-dione (PubChem CID 9297483) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297483 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (5R)-5-ethyl-3-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(/N=C\c2cc(OC)c3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H19N3O5/c1-3-20(14-7-5-4-6-8-14)18(24)23(19(25)22-20)21-11-13-9-15(26-2)17-16(10-13)27-12-28-17/h4-11H,3,12H2,1-2H3,(H,22,25)/b21-11-/t20-/m1/s1 |
| InChIKey | MOMJTJSBBGRRSJ-PBMUUGLVSA-N |
| XLogP | 2.62 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|