C21H19N3O3 — CID 9297456
(5R)-5-ethyl-5-phenyl-3-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 9297456) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (5R)-5-ethyl-5-phenyl-3-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-phenyl-3-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297456 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (5R)-5-ethyl-5-phenyl-3-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | C#CCOc1ccccc1/C=N\N1C(=O)N[C@](CC)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H19N3O3/c1-3-14-27-18-13-9-8-10-16(18)15-22-24-19(25)21(4-2,23-20(24)26)17-11-6-5-7-12-17/h1,5-13,15H,4,14H2,2H3,(H,23,26)/b22-15-/t21-/m1/s1 |
| InChIKey | WWVFRDVSTHVDLM-JHRFGPFWSA-N |
| XLogP | 2.89 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|