C23H25N3O4 — CID 9297403
(5R)-3-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9297403) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (5R)-3-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297403 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (5R)-3-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCOc1cc2c(cc1/C=N\N1C(=O)N[C@](CC)(c3ccccc3)C1=O)O[C@@H](C)C2 |
| InChI | InChI=1S/C23H25N3O4/c1-4-23(18-9-7-6-8-10-18)21(27)26(22(28)25-23)24-14-17-13-20-16(11-15(3)30-20)12-19(17)29-5-2/h6-10,12-15H,4-5,11H2,1-3H3,(H,25,28)/b24-14-/t15-,23+/m0/s1 |
| InChIKey | OUWRUQLHYVETDB-YVNFOTMHSA-N |
| XLogP | 3.60 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|