C21H23N3O5 — CID 9296728
(5R)-5-ethyl-5-phenyl-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 9296728) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (5R)-5-ethyl-5-phenyl-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-phenyl-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9296728 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (5R)-5-ethyl-5-phenyl-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(/N=C\c2cc(OC)c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C21H23N3O5/c1-5-21(15-9-7-6-8-10-15)19(25)24(20(26)23-21)22-13-14-11-17(28-3)18(29-4)12-16(14)27-2/h6-13H,5H2,1-4H3,(H,23,26)/b22-13-/t21-/m1/s1 |
| InChIKey | XOQHJGPXVQVIBD-BHMTVCBESA-N |
| XLogP | 2.90 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|