C23H22FN5O2 — CID 9297603
(5S)-5-ethyl-3-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-5-phenylimidazolidine-2,4-dione (PubChem CID 9297603) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is (5S)-5-ethyl-3-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-3-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9297603 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (5S)-5-ethyl-3-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(/N=C\c2c(C)nn(-c3ccc(F)cc3)c2C)C1=O |
| InChI | InChI=1S/C23H22FN5O2/c1-4-23(17-8-6-5-7-9-17)21(30)29(22(31)26-23)25-14-20-15(2)27-28(16(20)3)19-12-10-18(24)11-13-19/h5-14H,4H2,1-3H3,(H,26,31)/b25-14-/t23-/m0/s1 |
| InChIKey | TXDNEJSBWWIGFZ-HAMGHATCSA-N |
| XLogP | 3.82 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|