C24H17FN4O2 — CID 45114683
2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione (PubChem CID 45114683) has the molecular formula C24H17FN4O2 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 45114683 |
| Molecular Formula | C24H17FN4O2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C=NN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C24H17FN4O2/c1-14-21(15(2)28(27-14)18-11-9-17(25)10-12-18)13-26-29-23(30)19-7-3-5-16-6-4-8-20(22(16)19)24(29)31/h3-13H,1-2H3 |
| InChIKey | HLTVNPXHWQSWNM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|