C19H16FN5 — CID 9024138
(Z)-N-(benzimidazol-1-yl)-1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanimine (PubChem CID 9024138) has the molecular formula C19H16FN5 and a molecular weight of 333.37 g/mol. Its IUPAC name is (Z)-N-(benzimidazol-1-yl)-1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanimine.
| Compound Name | (Z)-N-(benzimidazol-1-yl)-1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 9024138 |
| Molecular Formula | C19H16FN5 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (Z)-N-(benzimidazol-1-yl)-1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanimine |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=N\n1cnc2ccccc21 |
| InChI | InChI=1S/C19H16FN5/c1-13-17(11-22-24-12-21-18-5-3-4-6-19(18)24)14(2)25(23-13)16-9-7-15(20)8-10-16/h3-12H,1-2H3/b22-11- |
| InChIKey | FLGSBIYTNJFKGH-JJFYIABZSA-N |
| XLogP | 3.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|