C25H21N3O2 — CID 21215006
2-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzo[de]isoquinoline-1,3-dione (PubChem CID 21215006) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 21215006 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(-n2nc(C)c(N3C(=O)c4cccc5cccc(c45)C3=O)c2C)cc1C |
| InChI | InChI=1S/C25H21N3O2/c1-14-11-12-19(13-15(14)2)28-17(4)23(16(3)26-28)27-24(29)20-9-5-7-18-8-6-10-21(22(18)20)25(27)30/h5-13H,1-4H3 |
| InChIKey | LAXUZLCTCGWAQY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|