C18H15N4O5- — CID 9297096
4-[(Z)-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]iminomethyl]-2-nitrophenolate (PubChem CID 9297096) has the molecular formula C18H15N4O5- and a molecular weight of 367.34 g/mol. Its IUPAC name is 4-[(Z)-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]iminomethyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]iminomethyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 9297096 |
| Molecular Formula | C18H15N4O5- |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-[(Z)-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]iminomethyl]-2-nitrophenolate |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(/N=C\c2ccc([O-])c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H16N4O5/c1-2-18(13-6-4-3-5-7-13)16(24)21(17(25)20-18)19-11-12-8-9-15(23)14(10-12)22(26)27/h3-11,23H,2H2,1H3,(H,20,25)/p-1/b19-11-/t18-/m0/s1 |
| InChIKey | OWGALJILOUQPSC-FUDBJYBQSA-M |
| XLogP | 1.86 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|