C21H21F2N3O5 — CID 4590732
5-[4-(difluoromethoxy)phenyl]-3-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-5-methylimidazolidine-2,4-dione (PubChem CID 4590732) has the molecular formula C21H21F2N3O5 and a molecular weight of 433.41 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-3-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-3-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4590732 |
| Molecular Formula | C21H21F2N3O5 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-3-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-5-methylimidazolidine-2,4-dione |
| SMILES | CCOc1ccc(C=NN2C(=O)NC(C)(c3ccc(OC(F)F)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H21F2N3O5/c1-4-30-16-10-5-13(11-17(16)29-3)12-24-26-18(27)21(2,25-20(26)28)14-6-8-15(9-7-14)31-19(22)23/h5-12,19H,4H2,1-3H3,(H,25,28) |
| InChIKey | WKABYMLTZVBALE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|