C17H14F2N4O3 — CID 2695896
(5S)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(pyridin-2-ylmethylideneamino)imidazolidine-2,4-dione (PubChem CID 2695896) has the molecular formula C17H14F2N4O3 and a molecular weight of 360.32 g/mol. Its IUPAC name is (5S)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(pyridin-2-ylmethylideneamino)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(pyridin-2-ylmethylideneamino)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2695896 |
| Molecular Formula | C17H14F2N4O3 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (5S)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(pyridin-2-ylmethylideneamino)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc(OC(F)F)cc2)NC(=O)N(N=Cc2ccccn2)C1=O |
| InChI | InChI=1S/C17H14F2N4O3/c1-17(11-5-7-13(8-6-11)26-15(18)19)14(24)23(16(25)22-17)21-10-12-4-2-3-9-20-12/h2-10,15H,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | KKMYAEIXZXNNTL-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|