C26H22ClF2N3O5 — CID 4037808
3-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 4037808) has the molecular formula C26H22ClF2N3O5 and a molecular weight of 529.93 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4037808 |
| Molecular Formula | C26H22ClF2N3O5 |
| Molecular Weight | 529.93 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cc(C=NN2C(=O)NC(C)(c3ccc(OC(F)F)cc3)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClF2N3O5/c1-26(18-6-10-20(11-7-18)37-24(28)29)23(33)32(25(34)31-26)30-14-17-5-12-21(22(13-17)35-2)36-15-16-3-8-19(27)9-4-16/h3-14,24H,15H2,1-2H3,(H,31,34) |
| InChIKey | FLMWYWXGYOBALS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|