C17H15Cl2N3O3 — CID 19375579
1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-(3-chloropropyl)imidazolidine-2,4-dione (PubChem CID 19375579) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-(3-chloropropyl)imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-(3-chloropropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19375579 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-(3-chloropropyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(/N=C/c2ccc(-c3ccc(Cl)cc3)o2)C(=O)N1CCCCl |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-8-1-9-21-16(23)11-22(17(21)24)20-10-14-6-7-15(25-14)12-2-4-13(19)5-3-12/h2-7,10H,1,8-9,11H2/b20-10+ |
| InChIKey | OIZQCDGXTBPTBX-KEBDBYFISA-N |
| XLogP | 3.83 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|