C18H19N5O6 — CID 138574610
[3-[(E)-[5-[4-(methoxyamino)phenyl]furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 2-aminoacetate (PubChem CID 138574610) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is [3-[(E)-[5-[4-(methoxyamino)phenyl]furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 2-aminoacetate.
| Compound Name | [3-[(E)-[5-[4-(methoxyamino)phenyl]furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 2-aminoacetate |
|---|---|
| PubChem CID | 138574610 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [3-[(E)-[5-[4-(methoxyamino)phenyl]furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 2-aminoacetate |
| SMILES | CONc1ccc(-c2ccc(/C=N/N3CC(=O)N(COC(=O)CN)C3=O)o2)cc1 |
| InChI | InChI=1S/C18H19N5O6/c1-27-21-13-4-2-12(3-5-13)15-7-6-14(29-15)9-20-23-10-16(24)22(18(23)26)11-28-17(25)8-19/h2-7,9,21H,8,10-11,19H2,1H3/b20-9+ |
| InChIKey | QKYRAKVAQBYMAV-AWQFTUOYSA-N |
| XLogP | 0.98 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|