C10H10N4O6 — CID 154206915
3-(2-hydroxyethyl)-1-[(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 154206915) has the molecular formula C10H10N4O6 and a molecular weight of 282.21 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1-[(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 3-(2-hydroxyethyl)-1-[(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154206915 |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(2-hydroxyethyl)-1-[(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | O=C1CN(N=Cc2ccc([N+](=O)[O-])o2)C(=O)N1CCO |
| InChI | InChI=1S/C10H10N4O6/c15-4-3-12-8(16)6-13(10(12)17)11-5-7-1-2-9(20-7)14(18)19/h1-2,5,15H,3-4,6H2 |
| InChIKey | TWLHXPNXGVFASI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|