C17H25N5O5 — CID 134119051
3-[3-[di(propan-2-yl)amino]propyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 134119051) has the molecular formula C17H25N5O5 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[3-[di(propan-2-yl)amino]propyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[di(propan-2-yl)amino]propyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134119051 |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[3-[di(propan-2-yl)amino]propyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | CC(C)N(CCCN1C(=O)CN(/N=C/c2ccc([N+](=O)[O-])o2)C1=O)C(C)C |
| InChI | InChI=1S/C17H25N5O5/c1-12(2)19(13(3)4)8-5-9-20-15(23)11-21(17(20)24)18-10-14-6-7-16(27-14)22(25)26/h6-7,10,12-13H,5,8-9,11H2,1-4H3/b18-10+ |
| InChIKey | BTORJINHMGGALK-VCHYOVAHSA-N |
| XLogP | 2.29 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|