C12H15N4O10P — CID 174806147
3-(hydroxymethyl)-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid (PubChem CID 174806147) has the molecular formula C12H15N4O10P and a molecular weight of 406.24 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid.
| Compound Name | 3-(hydroxymethyl)-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 174806147 |
| Molecular Formula | C12H15N4O10P |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-(hydroxymethyl)-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid |
| SMILES | C[C@@H]1O[C@@H]1P(=O)(O)O.O=C1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)N1CO |
| InChI | InChI=1S/C9H8N4O6.C3H7O4P/c14-5-11-7(15)4-12(9(11)16)10-3-6-1-2-8(19-6)13(17)18;1-2-3(7-2)8(4,5)6/h1-3,14H,4-5H2;2-3H,1H3,(H2,4,5,6)/b10-3+;/t;2-,3+/m.0/s1 |
| InChIKey | ILAXYCMUKHWXNF-JUANQJFYSA-N |
| XLogP | -0.36 |
| TPSA | 199.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|