C9H8N4O6 — CID 6436103
3-(hydroxymethyl)-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 6436103) has the molecular formula C9H8N4O6 and a molecular weight of 268.18 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 3-(hydroxymethyl)-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 6436103 |
| Molecular Formula | C9H8N4O6 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-(hydroxymethyl)-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | O=C1CN(/N=C\c2ccc([N+](=O)[O-])o2)C(=O)N1CO |
| InChI | InChI=1S/C9H8N4O6/c14-5-11-7(15)4-12(9(11)16)10-3-6-1-2-8(19-6)13(17)18/h1-3,14H,4-5H2/b10-3- |
| InChIKey | UIDWQGRXEVDFCA-KMKOMSMNSA-N |
| XLogP | -0.26 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|