C14H15N7O8 — CID 174828543
2-(2-methyl-5-nitroimidazol-1-yl)ethanol;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 174828543) has the molecular formula C14H15N7O8 and a molecular weight of 409.32 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174828543 |
| Molecular Formula | C14H15N7O8 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO.O=C1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)N1 |
| InChI | InChI=1S/C8H6N4O5.C6H9N3O3/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16;1-5-7-4-6(9(11)12)8(5)2-3-10/h1-3H,4H2,(H,10,13,14);4,10H,2-3H2,1H3/b9-3+; |
| InChIKey | GMMKLZIFHCOADX-JSGFVSQVSA-N |
| XLogP | 0.17 |
| TPSA | 199.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|