C8H7N4O5+ — CID 157046616
[5-[(E)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]furan-2-yl]-hydroxy-oxoazanium (PubChem CID 157046616) has the molecular formula C8H7N4O5+ and a molecular weight of 239.17 g/mol. Its IUPAC name is [5-[(E)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]furan-2-yl]-hydroxy-oxoazanium.
| Compound Name | [5-[(E)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]furan-2-yl]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 157046616 |
| Molecular Formula | C8H7N4O5+ |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [5-[(E)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]furan-2-yl]-hydroxy-oxoazanium |
| SMILES | O=C1CN(/N=C/c2ccc([N+](=O)O)o2)C(=O)N1 |
| InChI | InChI=1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H-,10,13,14,15,16)/p+1/b9-3+ |
| InChIKey | NWEQYUVLPREKAG-YCRREMRBSA-O |
| XLogP | -0.04 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|