C20H18N5O5+ — CID 22750243
1-methylpyridin-1-ium;1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 22750243) has the molecular formula C20H18N5O5+ and a molecular weight of 408.39 g/mol. Its IUPAC name is 1-methylpyridin-1-ium;1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-methylpyridin-1-ium;1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22750243 |
| Molecular Formula | C20H18N5O5+ |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-methylpyridin-1-ium;1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | C[n+]1ccccc1.O=C1CN(/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)C(=O)N1 |
| InChI | InChI=1S/C14H10N4O5.C6H8N/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22;1-7-5-3-2-4-6-7/h1-7H,8H2,(H,16,19,20);2-6H,1H3/q;+1/b15-7+; |
| InChIKey | MZVUQTMGKUCNEC-HAZZGOGXSA-N |
| XLogP | 2.25 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|