C14H10N6O3 — CID 10448086
1-[(E)-[5-(4-azidophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 10448086) has the molecular formula C14H10N6O3 and a molecular weight of 310.27 g/mol. Its IUPAC name is 1-[(E)-[5-(4-azidophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-[5-(4-azidophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10448086 |
| Molecular Formula | C14H10N6O3 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-[(E)-[5-(4-azidophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | [N-]=[N+]=Nc1ccc(-c2ccc(/C=N/N3CC(=O)NC3=O)o2)cc1 |
| InChI | InChI=1S/C14H10N6O3/c15-19-18-10-3-1-9(2-4-10)12-6-5-11(23-12)7-16-20-8-13(21)17-14(20)22/h1-7H,8H2,(H,17,21,22)/b16-7+ |
| InChIKey | NGXFSJFFDPPDAW-FRKPEAEDSA-N |
| XLogP | 2.77 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|