C8H6N4NaO5 — CID 77176029
2,4-Imidazolidinedione, 1-[[(5-nitro-2-furanyl)methylene]amino]-, sodium salt (1:1) (PubChem CID 77176029) has the molecular formula C8H6N4NaO5 and a molecular weight of 261.15 g/mol.
| Compound Name | 2,4-Imidazolidinedione, 1-[[(5-nitro-2-furanyl)methylene]amino]-, sodium salt (1:1) |
|---|---|
| PubChem CID | 77176029 |
| Molecular Formula | C8H6N4NaO5 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | — |
| SMILES | O=C1CN(N=Cc2ccc([N+](=O)[O-])o2)C(=O)N1.[Na] |
| InChI | InChI=1S/C8H6N4O5.Na/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16;/h1-3H,4H2,(H,10,13,14); |
| InChIKey | IGEOXMZNNDNZOY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|