C19H17N5O8 — CID 172941817
[3-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 4-amino-4-oxobutanoate (PubChem CID 172941817) has the molecular formula C19H17N5O8 and a molecular weight of 443.37 g/mol. Its IUPAC name is [3-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 4-amino-4-oxobutanoate.
| Compound Name | [3-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 172941817 |
| Molecular Formula | C19H17N5O8 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [3-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]methyl 4-amino-4-oxobutanoate |
| SMILES | NC(=O)CCC(=O)OCN1C(=O)CN(/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)C1=O |
| InChI | InChI=1S/C19H17N5O8/c20-16(25)7-8-18(27)31-11-22-17(26)10-23(19(22)28)21-9-14-5-6-15(32-14)12-1-3-13(4-2-12)24(29)30/h1-6,9H,7-8,10-11H2,(H2,20,25)/b21-9+ |
| InChIKey | SPLMVNIXEZDGFB-ZVBGSRNCSA-N |
| XLogP | 1.22 |
| TPSA | 178.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|